ibnuhabesha99 ibnuhabesha99

31-05-2021
Physics

contestada

Helpon
Brainly
En
ኦሊቭ አካዳሚ
Olive Academy
Subjects Physics
Name: Hanan
hussen
Roll No Grade 10
Date

Respuesta :

nunudagurll nunudagurll

31-05-2021

Answer:

huh ?ion understand

Explanation:

have a bad day <3

Answer Link

Otras preguntas

Which of the following statements is true about cohesion? The higher the cohesion, more localized will be the impact due to any change in the environment at a l

phosphorus trichloride is (Polar/Non-Polar) molecule. Its intermolecular bonds are (dispersion forces/dipole-dipole forces/hydrogen bonding/ion-dipole forces) *

Now it is your turn. Synthesize information from Journals of Yesterday's Missionaries and Called to Serve" in a paragraph of your own. Use at least one quote fr

1. A new Venite species has been discovered. There is no fossil evidence to suggest the relative evolutionary age of this new species. 2. Explain how you create

The distance between Delhi and Agra is 240 km. A train starts from Delhi towards Agra. A bird starts at the same time from Agra straight towards the moving trai

In a Wimbledon tournament, Roger Federer served a ball at 147 mph. In feet per centisecond he hit the ball to (or past) Sam Groth .268 seconds later with the fo

Draw the compound that will produce the following in McLafferty Rearrangement (image attached)

Identify the expected major product of the following reaction. [tex]\underset{\mathrm{H}_3 \mathrm{O}^{+}}{\longrightarrow}[/tex] ?CC(C)C(C)(O)COCC(O)C(C)(C)OCC

Directions: Find the value of each variable. 11) x=? y=? 12) x=? y=? 13) x=? y=? 14) x=? y=? 15) x=? y=? z=?

Animal cells typically achieve cytokinesis by a binary fission. b chromosome condensation. c. forming a cleavage furrow that pinches the cell into two. d formin