Mnshirhamysia Mnshirhamysia

30-06-2016
Mathematics

contestada

Simplify the rational expression. state any excluded values. x2-x-6/x 2

Respuesta :

braedenlee braedenlee

30-06-2016

So excluded values are x=3 and x=-2. Fully simplified form:

1 over

x+2

Answer Link

Otras preguntas

How do programmers write their own functions in a program?

Part F Identify at least two limitations of the simulation. How do these limitation ability to model the synthesis of ammonia?

You have selected a child of mass m = 25 kg (shown on the right), and an adult of mass n =3 times the mass of the child (shown on the left) to test out your pro

Which 2 ways can the Exceptions to Closing Date report be accessed? (Select all that apply) Accountant Tools [tex]\ \textgreater \ [/tex] Accountant Reports [t

2) Provide a systematic name for each of the following compounds below:CCCCC(CC)C(C)C(C)CCCCCC(CC)C(C)CCC(C)C(C(C)C)C(C)C

A motocross bike drives off of a jump angled at 45°. When the bike leaves the jump, it has a speed of 20 m/s (about 40 mph). To ensure a smooth landing, the lan

Women in the upper casted 2. How did the rule of the Gupta Dynasty reinforce patriarchy? In other words, what systems were in place regarding property, educatio

Which of the following is NOT part of the financial planning process?

Which of the following statements about CH3OH and CH2O are true? The molecules of CH3OH can form London forces, dipole/dipole forces, and hydrogen bonds. The CH

Identify three types of scientists who could be called upon to investigate the nuclear leak. Why would these scientists be helpful in determining if, and how mu